C18H14BrFN2O — CID 32854805
(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-fluorophenyl)methanone (PubChem CID 32854805) has the molecular formula C18H14BrFN2O and a molecular weight of 373.23 g/mol. Its IUPAC name is (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-fluorophenyl)methanone.
| Compound Name | (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 32854805 |
| Molecular Formula | C18H14BrFN2O |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCc2[nH]c3ccc(Br)cc3c2C1 |
| InChI | InChI=1S/C18H14BrFN2O/c19-11-5-6-16-13(9-11)14-10-22(8-7-17(14)21-16)18(23)12-3-1-2-4-15(12)20/h1-6,9,21H,7-8,10H2 |
| InChIKey | QMVRMTUIHJNCCQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|