C19H23BrN2O3 — CID 175679371
8-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-8-oxooctanoic acid (PubChem CID 175679371) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is 8-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-8-oxooctanoic acid.
| Compound Name | 8-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-8-oxooctanoic acid |
|---|---|
| PubChem CID | 175679371 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 8-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)N1CCc2[nH]c3ccc(Br)cc3c2C1 |
| InChI | InChI=1S/C19H23BrN2O3/c20-13-7-8-16-14(11-13)15-12-22(10-9-17(15)21-16)18(23)5-3-1-2-4-6-19(24)25/h7-8,11,21H,1-6,9-10,12H2,(H,24,25) |
| InChIKey | BBOIDRXERFCITF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|