C19H20FN3O — CID 125138508
1-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-pyrrol-1-ylbutan-1-one (PubChem CID 125138508) has the molecular formula C19H20FN3O and a molecular weight of 325.39 g/mol. Its IUPAC name is 1-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-pyrrol-1-ylbutan-1-one.
| Compound Name | 1-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-pyrrol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 125138508 |
| Molecular Formula | C19H20FN3O |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-pyrrol-1-ylbutan-1-one |
| SMILES | O=C(CCCn1cccc1)N1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C19H20FN3O/c20-14-5-6-17-15(12-14)16-13-23(11-7-18(16)21-17)19(24)4-3-10-22-8-1-2-9-22/h1-2,5-6,8-9,12,21H,3-4,7,10-11,13H2 |
| InChIKey | ALLMOXMTQHKPKZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|