C25H27FN4O4S — CID 30858190
1-[4-(benzenesulfonyl)piperazin-1-yl]-4-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butane-1,4-dione (PubChem CID 30858190) has the molecular formula C25H27FN4O4S and a molecular weight of 498.58 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-4-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butane-1,4-dione.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-4-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 30858190 |
| Molecular Formula | C25H27FN4O4S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-4-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCc2[nH]c3ccc(F)cc3c2C1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27FN4O4S/c26-18-6-7-22-20(16-18)21-17-29(11-10-23(21)27-22)25(32)9-8-24(31)28-12-14-30(15-13-28)35(33,34)19-4-2-1-3-5-19/h1-7,16,27H,8-15,17H2 |
| InChIKey | OUVNBJNSMXGYEY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|