C23H25N3O3S — CID 27509510
[4-(benzenesulfonyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone (PubChem CID 27509510) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone |
|---|---|
| PubChem CID | 27509510 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone |
| SMILES | O=C(c1ccc2[nH]c3c(c2c1)CCCC3)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N3O3S/c27-23(17-10-11-22-20(16-17)19-8-4-5-9-21(19)24-22)25-12-14-26(15-13-25)30(28,29)18-6-2-1-3-7-18/h1-3,6-7,10-11,16,24H,4-5,8-9,12-15H2 |
| InChIKey | VWNOAMFXBBTVFV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|