C23H27N3OS — CID 22017564
6,7,8,9-tetrahydro-5H-carbazol-3-yl-[4-(1-thiophen-2-ylethyl)piperazin-1-yl]methanone (PubChem CID 22017564) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-carbazol-3-yl-[4-(1-thiophen-2-ylethyl)piperazin-1-yl]methanone.
| Compound Name | 6,7,8,9-tetrahydro-5H-carbazol-3-yl-[4-(1-thiophen-2-ylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22017564 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-carbazol-3-yl-[4-(1-thiophen-2-ylethyl)piperazin-1-yl]methanone |
| SMILES | CC(c1cccs1)N1CCN(C(=O)c2ccc3[nH]c4c(c3c2)CCCC4)CC1 |
| InChI | InChI=1S/C23H27N3OS/c1-16(22-7-4-14-28-22)25-10-12-26(13-11-25)23(27)17-8-9-21-19(15-17)18-5-2-3-6-20(18)24-21/h4,7-9,14-16,24H,2-3,5-6,10-13H2,1H3 |
| InChIKey | ASPCYGJDFCMCOR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|