C24H27N3O — CID 25398074
[4-(3-methylphenyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone (PubChem CID 25398074) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is [4-(3-methylphenyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone.
| Compound Name | [4-(3-methylphenyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone |
|---|---|
| PubChem CID | 25398074 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | [4-(3-methylphenyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc4[nH]c5c(c4c3)CCCC5)CC2)c1 |
| InChI | InChI=1S/C24H27N3O/c1-17-5-4-6-19(15-17)26-11-13-27(14-12-26)24(28)18-9-10-23-21(16-18)20-7-2-3-8-22(20)25-23/h4-6,9-10,15-16,25H,2-3,7-8,11-14H2,1H3 |
| InChIKey | GSSSJLZVEBQEIZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|