C22H30N4O2 — CID 102603763
N-propyl-2-[4-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperazin-1-yl]acetamide (PubChem CID 102603763) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-propyl-2-[4-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-propyl-2-[4-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 102603763 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-propyl-2-[4-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperazin-1-yl]acetamide |
| SMILES | CCCNC(=O)CN1CCN(C(=O)c2ccc3[nH]c4c(c3c2)CCCC4)CC1 |
| InChI | InChI=1S/C22H30N4O2/c1-2-9-23-21(27)15-25-10-12-26(13-11-25)22(28)16-7-8-20-18(14-16)17-5-3-4-6-19(17)24-20/h7-8,14,24H,2-6,9-13,15H2,1H3,(H,23,27) |
| InChIKey | FSEFQKKUJQLFSX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|