C19H30N4O2 — CID 43020080
N-butyl-2-[4-[4-(dimethylamino)benzoyl]piperazin-1-yl]acetamide (PubChem CID 43020080) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-butyl-2-[4-[4-(dimethylamino)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[4-(dimethylamino)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 43020080 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N-butyl-2-[4-[4-(dimethylamino)benzoyl]piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)c2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-4-5-10-20-18(24)15-22-11-13-23(14-12-22)19(25)16-6-8-17(9-7-16)21(2)3/h6-9H,4-5,10-15H2,1-3H3,(H,20,24) |
| InChIKey | PSHQPVJUSKTUFT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|