C15H23N3O3 — CID 35358737
N-butyl-2-[4-(furan-3-carbonyl)piperazin-1-yl]acetamide (PubChem CID 35358737) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-butyl-2-[4-(furan-3-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-(furan-3-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 35358737 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-butyl-2-[4-(furan-3-carbonyl)piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C15H23N3O3/c1-2-3-5-16-14(19)11-17-6-8-18(9-7-17)15(20)13-4-10-21-12-13/h4,10,12H,2-3,5-9,11H2,1H3,(H,16,19) |
| InChIKey | BUQWTTGBMRPNON-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|