C18H27N3O2 — CID 8597427
2-(4-benzoylpiperazin-1-yl)-N-pentylacetamide (PubChem CID 8597427) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-yl)-N-pentylacetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-yl)-N-pentylacetamide |
|---|---|
| PubChem CID | 8597427 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-yl)-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O2/c1-2-3-7-10-19-17(22)15-20-11-13-21(14-12-20)18(23)16-8-5-4-6-9-16/h4-6,8-9H,2-3,7,10-15H2,1H3,(H,19,22) |
| InChIKey | PJQQHNCGYHKFBL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|