C20H28N6O2 — CID 43020077
N-butyl-2-[4-(5-methyl-2-phenyltriazole-4-carbonyl)piperazin-1-yl]acetamide (PubChem CID 43020077) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-butyl-2-[4-(5-methyl-2-phenyltriazole-4-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-(5-methyl-2-phenyltriazole-4-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 43020077 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | N-butyl-2-[4-(5-methyl-2-phenyltriazole-4-carbonyl)piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)c2nn(-c3ccccc3)nc2C)CC1 |
| InChI | InChI=1S/C20H28N6O2/c1-3-4-10-21-18(27)15-24-11-13-25(14-12-24)20(28)19-16(2)22-26(23-19)17-8-6-5-7-9-17/h5-9H,3-4,10-15H2,1-2H3,(H,21,27) |
| InChIKey | ULXSRNORMJEBFT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|