C17H23Cl2N3O2 — CID 35357599
N-butyl-2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]acetamide (PubChem CID 35357599) has the molecular formula C17H23Cl2N3O2 and a molecular weight of 372.30 g/mol. Its IUPAC name is N-butyl-2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 35357599 |
| Molecular Formula | C17H23Cl2N3O2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-butyl-2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23Cl2N3O2/c1-2-3-6-20-16(23)12-21-7-9-22(10-8-21)17(24)13-4-5-14(18)15(19)11-13/h4-5,11H,2-3,6-10,12H2,1H3,(H,20,23) |
| InChIKey | FMPAATKIGROMRP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|