C21H31N3O2S2 — CID 18163281
N-butyl-2-[4-[4-(1,3-dithian-2-yl)benzoyl]piperazin-1-yl]acetamide (PubChem CID 18163281) has the molecular formula C21H31N3O2S2 and a molecular weight of 421.63 g/mol. Its IUPAC name is N-butyl-2-[4-[4-(1,3-dithian-2-yl)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[4-(1,3-dithian-2-yl)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 18163281 |
| Molecular Formula | C21H31N3O2S2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-butyl-2-[4-[4-(1,3-dithian-2-yl)benzoyl]piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)c2ccc(C3SCCCS3)cc2)CC1 |
| InChI | InChI=1S/C21H31N3O2S2/c1-2-3-9-22-19(25)16-23-10-12-24(13-11-23)20(26)17-5-7-18(8-6-17)21-27-14-4-15-28-21/h5-8,21H,2-4,9-16H2,1H3,(H,22,25) |
| InChIKey | DGKFFSCRRYCEDL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|