C22H24N2O2S2 — CID 32758997
[4-[4-(1,3-dithian-2-yl)benzoyl]piperazin-1-yl]-phenylmethanone (PubChem CID 32758997) has the molecular formula C22H24N2O2S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is [4-[4-(1,3-dithian-2-yl)benzoyl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[4-(1,3-dithian-2-yl)benzoyl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 32758997 |
| Molecular Formula | C22H24N2O2S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [4-[4-(1,3-dithian-2-yl)benzoyl]piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(C(=O)c2ccc(C3SCCCS3)cc2)CC1 |
| InChI | InChI=1S/C22H24N2O2S2/c25-20(17-5-2-1-3-6-17)23-11-13-24(14-12-23)21(26)18-7-9-19(10-8-18)22-27-15-4-16-28-22/h1-3,5-10,22H,4,11-16H2 |
| InChIKey | ZUSWSQDLUXBSOD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |