C18H22N2O2 — CID 41247140
[(2S)-2-methylmorpholin-4-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone (PubChem CID 41247140) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is [(2S)-2-methylmorpholin-4-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone.
| Compound Name | [(2S)-2-methylmorpholin-4-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone |
|---|---|
| PubChem CID | 41247140 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [(2S)-2-methylmorpholin-4-yl]-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone |
| SMILES | C[C@H]1CN(C(=O)c2ccc3[nH]c4c(c3c2)CCCC4)CCO1 |
| InChI | InChI=1S/C18H22N2O2/c1-12-11-20(8-9-22-12)18(21)13-6-7-17-15(10-13)14-4-2-3-5-16(14)19-17/h6-7,10,12,19H,2-5,8-9,11H2,1H3/t12-/m0/s1 |
| InChIKey | RWAQCKQHPCSMAN-LBPRGKRZSA-N |
| XLogP | 2.91 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|