C21H28N2O — CID 51723997
[(3S,5S)-3,5-dimethylpiperidin-1-yl]-[(6S)-6-methyl-6,7,8,9-tetrahydro-5H-carbazol-3-yl]methanone (PubChem CID 51723997) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is [(3S,5S)-3,5-dimethylpiperidin-1-yl]-[(6S)-6-methyl-6,7,8,9-tetrahydro-5H-carbazol-3-yl]methanone.
| Compound Name | [(3S,5S)-3,5-dimethylpiperidin-1-yl]-[(6S)-6-methyl-6,7,8,9-tetrahydro-5H-carbazol-3-yl]methanone |
|---|---|
| PubChem CID | 51723997 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | [(3S,5S)-3,5-dimethylpiperidin-1-yl]-[(6S)-6-methyl-6,7,8,9-tetrahydro-5H-carbazol-3-yl]methanone |
| SMILES | C[C@H]1CCc2[nH]c3ccc(C(=O)N4C[C@@H](C)C[C@H](C)C4)cc3c2C1 |
| InChI | InChI=1S/C21H28N2O/c1-13-4-6-19-17(9-13)18-10-16(5-7-20(18)22-19)21(24)23-11-14(2)8-15(3)12-23/h5,7,10,13-15,22H,4,6,8-9,11-12H2,1-3H3/t13-,14-,15-/m0/s1 |
| InChIKey | IVKFSFTWALNPEC-KKUMJFAQSA-N |
| XLogP | 4.41 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|