C27H30N6O — CID 154836446
[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(6-methyl-6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone (PubChem CID 154836446) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is [4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(6-methyl-6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone.
| Compound Name | [4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(6-methyl-6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone |
|---|---|
| PubChem CID | 154836446 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(6-methyl-6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone |
| SMILES | CC1CCc2[nH]c3ccc(C(=O)N4CCN(Cc5nc(N)c6ccccc6n5)CC4)cc3c2C1 |
| InChI | InChI=1S/C27H30N6O/c1-17-6-8-23-20(14-17)21-15-18(7-9-24(21)29-23)27(34)33-12-10-32(11-13-33)16-25-30-22-5-3-2-4-19(22)26(28)31-25/h2-5,7,9,15,17,29H,6,8,10-14,16H2,1H3,(H2,28,30,31) |
| InChIKey | GKCYRERVKWNYCR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|