C18H19N5O2 — CID 34953369
[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone (PubChem CID 34953369) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is [4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 34953369 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone |
| SMILES | Nc1nc(CN2CCN(C(=O)c3ccoc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C18H19N5O2/c19-17-14-3-1-2-4-15(14)20-16(21-17)11-22-6-8-23(9-7-22)18(24)13-5-10-25-12-13/h1-5,10,12H,6-9,11H2,(H2,19,20,21) |
| InChIKey | PUPKJSFOTWYJCL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |