C27H24N6OS — CID 37129585
2-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazine-1-carbonyl]phenyl]sulfanylbenzonitrile (PubChem CID 37129585) has the molecular formula C27H24N6OS and a molecular weight of 480.60 g/mol. Its IUPAC name is 2-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazine-1-carbonyl]phenyl]sulfanylbenzonitrile.
| Compound Name | 2-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazine-1-carbonyl]phenyl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 37129585 |
| Molecular Formula | C27H24N6OS |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazine-1-carbonyl]phenyl]sulfanylbenzonitrile |
| SMILES | N#Cc1ccccc1Sc1ccccc1C(=O)N1CCN(Cc2nc(N)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C27H24N6OS/c28-17-19-7-1-5-11-23(19)35-24-12-6-3-9-21(24)27(34)33-15-13-32(14-16-33)18-25-30-22-10-4-2-8-20(22)26(29)31-25/h1-12H,13-16,18H2,(H2,29,30,31) |
| InChIKey | BOYCEONRNCIINV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |