C20H23N5O3 — CID 167806447
1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazine-1-carbonyl]cyclopent-3-ene-1-carboxylic acid (PubChem CID 167806447) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazine-1-carbonyl]cyclopent-3-ene-1-carboxylic acid.
| Compound Name | 1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazine-1-carbonyl]cyclopent-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 167806447 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazine-1-carbonyl]cyclopent-3-ene-1-carboxylic acid |
| SMILES | Nc1nc(CN2CCN(C(=O)C3(C(=O)O)CC=CC3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H23N5O3/c21-17-14-5-1-2-6-15(14)22-16(23-17)13-24-9-11-25(12-10-24)18(26)20(19(27)28)7-3-4-8-20/h1-6H,7-13H2,(H,27,28)(H2,21,22,23) |
| InChIKey | XGSGVECZSZQUCH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|