C18H22N6O2 — CID 166411504
N-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 166411504) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166411504 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-[2-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)N1CCN(Cc2nc(N)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C18H22N6O2/c1-2-16(25)20-11-17(26)24-9-7-23(8-10-24)12-15-21-14-6-4-3-5-13(14)18(19)22-15/h2-6H,1,7-12H2,(H,20,25)(H2,19,21,22) |
| InChIKey | FZASGZNUKRVJNM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|