C25H28N6O — CID 33120411
1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one (PubChem CID 33120411) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one.
| Compound Name | 1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 33120411 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
| SMILES | Nc1nc(CN2CCN(C(=O)CCCc3c[nH]c4ccccc34)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H28N6O/c26-25-20-8-2-4-10-22(20)28-23(29-25)17-30-12-14-31(15-13-30)24(32)11-5-6-18-16-27-21-9-3-1-7-19(18)21/h1-4,7-10,16,27H,5-6,11-15,17H2,(H2,26,28,29) |
| InChIKey | RLVIGRQNJDGWRK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |