C18H21N7O — CID 37131062
[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone (PubChem CID 37131062) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is [4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone.
| Compound Name | [4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 37131062 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone |
| SMILES | Cn1cc(C(=O)N2CCN(Cc3nc(N)c4ccccc4n3)CC2)cn1 |
| InChI | InChI=1S/C18H21N7O/c1-23-11-13(10-20-23)18(26)25-8-6-24(7-9-25)12-16-21-15-5-3-2-4-14(15)17(19)22-16/h2-5,10-11H,6-9,12H2,1H3,(H2,19,21,22) |
| InChIKey | NFHMNFMPVYCFSM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |