C27H29N3O2 — CID 154833822
3-[1-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperidin-4-yl]-1,3-dihydroindol-2-one (PubChem CID 154833822) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-[1-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperidin-4-yl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[1-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperidin-4-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 154833822 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 3-[1-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperidin-4-yl]-1,3-dihydroindol-2-one |
| SMILES | CC1CCc2[nH]c3ccc(C(=O)N4CCC(C5C(=O)Nc6ccccc65)CC4)cc3c2C1 |
| InChI | InChI=1S/C27H29N3O2/c1-16-6-8-23-20(14-16)21-15-18(7-9-24(21)28-23)27(32)30-12-10-17(11-13-30)25-19-4-2-3-5-22(19)29-26(25)31/h2-5,7,9,15-17,25,28H,6,8,10-14H2,1H3,(H,29,31) |
| InChIKey | ANYPCEGVLYDUNA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|