C20H25N3O2 — CID 41099535
1-[(6S)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl]piperidine-4-carboxamide (PubChem CID 41099535) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[(6S)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(6S)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41099535 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-[(6S)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl]piperidine-4-carboxamide |
| SMILES | C[C@H]1CCc2[nH]c3ccc(C(=O)N4CCC(C(N)=O)CC4)cc3c2C1 |
| InChI | InChI=1S/C20H25N3O2/c1-12-2-4-17-15(10-12)16-11-14(3-5-18(16)22-17)20(25)23-8-6-13(7-9-23)19(21)24/h3,5,11-13,22H,2,4,6-10H2,1H3,(H2,21,24)/t12-/m0/s1 |
| InChIKey | WELDQULCYIEYQZ-LBPRGKRZSA-N |
| XLogP | 2.63 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|