C18H24N2O3 — CID 110878264
N,N-bis(2-hydroxyethyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 110878264) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 110878264 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CC1CCc2[nH]c3ccc(C(=O)N(CCO)CCO)cc3c2C1 |
| InChI | InChI=1S/C18H24N2O3/c1-12-2-4-16-14(10-12)15-11-13(3-5-17(15)19-16)18(23)20(6-8-21)7-9-22/h3,5,11-12,19,21-22H,2,4,6-10H2,1H3 |
| InChIKey | VZWOGVBRVZVVHL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|