C24H27N3O2 — CID 27226950
(6R)-N,6-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 27226950) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is (6R)-N,6-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | (6R)-N,6-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 27226950 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (6R)-N,6-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)CN(C)C(=O)c2ccc3[nH]c4c(c3c2)C[C@H](C)CC4)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-15-4-8-18(9-5-15)25-23(28)14-27(3)24(29)17-7-11-22-20(13-17)19-12-16(2)6-10-21(19)26-22/h4-5,7-9,11,13,16,26H,6,10,12,14H2,1-3H3,(H,25,28)/t16-/m1/s1 |
| InChIKey | UBJOTTXAKAJINM-MRXNPFEDSA-N |
| XLogP | 4.31 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|