C18H24N2O — CID 4612444
N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)pentanamide (PubChem CID 4612444) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)pentanamide.
| Compound Name | N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 4612444 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)pentanamide |
| SMILES | CCCCC(=O)NCc1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C18H24N2O/c1-2-3-8-18(21)19-12-13-9-10-17-15(11-13)14-6-4-5-7-16(14)20-17/h9-11,20H,2-8,12H2,1H3,(H,19,21) |
| InChIKey | VXAAQOLFPZTIOX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|