C24H29N3S — CID 4220236
1-(2,6-diethylphenyl)-3-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)thiourea (PubChem CID 4220236) has the molecular formula C24H29N3S and a molecular weight of 391.58 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)thiourea.
| Compound Name | 1-(2,6-diethylphenyl)-3-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4220236 |
| Molecular Formula | C24H29N3S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)NCc1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C24H29N3S/c1-3-17-8-7-9-18(4-2)23(17)27-24(28)25-15-16-12-13-22-20(14-16)19-10-5-6-11-21(19)26-22/h7-9,12-14,26H,3-6,10-11,15H2,1-2H3,(H2,25,27,28) |
| InChIKey | KEDZWPUQYNUAIV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|