C18H23N3O3 — CID 56879720
methyl (2S)-2-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethylcarbamoylamino)propanoate (PubChem CID 56879720) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl (2S)-2-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethylcarbamoylamino)propanoate.
| Compound Name | methyl (2S)-2-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 56879720 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | methyl (2S)-2-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethylcarbamoylamino)propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)NCc1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C18H23N3O3/c1-11(17(22)24-2)20-18(23)19-10-12-7-8-16-14(9-12)13-5-3-4-6-15(13)21-16/h7-9,11,21H,3-6,10H2,1-2H3,(H2,19,20,23)/t11-/m0/s1 |
| InChIKey | UANDIZNIFCPBEV-NSHDSACASA-N |
| XLogP | 2.41 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|