C23H34N4O — CID 95557304
(4R)-4-(4-methylpiperazin-1-yl)-N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)pentanamide (PubChem CID 95557304) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is (4R)-4-(4-methylpiperazin-1-yl)-N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)pentanamide.
| Compound Name | (4R)-4-(4-methylpiperazin-1-yl)-N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 95557304 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (4R)-4-(4-methylpiperazin-1-yl)-N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)pentanamide |
| SMILES | C[C@H](CCC(=O)NCc1ccc2[nH]c3c(c2c1)CCCC3)N1CCN(C)CC1 |
| InChI | InChI=1S/C23H34N4O/c1-17(27-13-11-26(2)12-14-27)7-10-23(28)24-16-18-8-9-22-20(15-18)19-5-3-4-6-21(19)25-22/h8-9,15,17,25H,3-7,10-14,16H2,1-2H3,(H,24,28)/t17-/m1/s1 |
| InChIKey | OKSVAGJHHDOMJH-QGZVFWFLSA-N |
| XLogP | 3.08 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|