C22H20N2O2 — CID 3297671
N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)-1-benzofuran-2-carboxamide (PubChem CID 3297671) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3297671 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCc1ccc2[nH]c3c(c2c1)CCCC3)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H20N2O2/c25-22(21-12-15-5-1-4-8-20(15)26-21)23-13-14-9-10-19-17(11-14)16-6-2-3-7-18(16)24-19/h1,4-5,8-12,24H,2-3,6-7,13H2,(H,23,25) |
| InChIKey | GOMSGADTWHFDRB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|