C21H20N4O — CID 8990549
1-(2-cyanophenyl)-3-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)urea (PubChem CID 8990549) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)urea.
| Compound Name | 1-(2-cyanophenyl)-3-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 8990549 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-(2-cyanophenyl)-3-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)urea |
| SMILES | N#Cc1ccccc1NC(=O)NCc1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C21H20N4O/c22-12-15-5-1-3-7-18(15)25-21(26)23-13-14-9-10-20-17(11-14)16-6-2-4-8-19(16)24-20/h1,3,5,7,9-11,24H,2,4,6,8,13H2,(H2,23,25,26) |
| InChIKey | LKPRXQIBBRUDTB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|