C19H27N3O — CID 138041779
(2,3-dimethyl-1H-indol-5-yl)-(4-propan-2-yl-1,4-diazepan-1-yl)methanone (PubChem CID 138041779) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-(4-propan-2-yl-1,4-diazepan-1-yl)methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-(4-propan-2-yl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 138041779 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-(4-propan-2-yl-1,4-diazepan-1-yl)methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCCN(C(C)C)CC3)cc2c1C |
| InChI | InChI=1S/C19H27N3O/c1-13(2)21-8-5-9-22(11-10-21)19(23)16-6-7-18-17(12-16)14(3)15(4)20-18/h6-7,12-13,20H,5,8-11H2,1-4H3 |
| InChIKey | YVPDKAMNLFEIFU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|