C20H20N2O — CID 4788431
3,4-dihydro-1H-isoquinolin-2-yl-(2,3-dimethyl-1H-indol-5-yl)methanone (PubChem CID 4788431) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl-(2,3-dimethyl-1H-indol-5-yl)methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl-(2,3-dimethyl-1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 4788431 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl-(2,3-dimethyl-1H-indol-5-yl)methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCc4ccccc4C3)cc2c1C |
| InChI | InChI=1S/C20H20N2O/c1-13-14(2)21-19-8-7-16(11-18(13)19)20(23)22-10-9-15-5-3-4-6-17(15)12-22/h3-8,11,21H,9-10,12H2,1-2H3 |
| InChIKey | RCFUXHPSZLQFOL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|