C16H19N3O2 — CID 64694144
4-(2,3-dimethyl-1H-indole-5-carbonyl)-1-methylpiperazin-2-one (PubChem CID 64694144) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(2,3-dimethyl-1H-indole-5-carbonyl)-1-methylpiperazin-2-one.
| Compound Name | 4-(2,3-dimethyl-1H-indole-5-carbonyl)-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 64694144 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-(2,3-dimethyl-1H-indole-5-carbonyl)-1-methylpiperazin-2-one |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCN(C)C(=O)C3)cc2c1C |
| InChI | InChI=1S/C16H19N3O2/c1-10-11(2)17-14-5-4-12(8-13(10)14)16(21)19-7-6-18(3)15(20)9-19/h4-5,8,17H,6-7,9H2,1-3H3 |
| InChIKey | YGAHCTYCLJAJSK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|