C22H26N4O — CID 136525932
(2,3-dimethyl-1H-indol-5-yl)-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]methanone (PubChem CID 136525932) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 136525932 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCN(C(C)c4cccnc4)CC3)cc2c1C |
| InChI | InChI=1S/C22H26N4O/c1-15-16(2)24-21-7-6-18(13-20(15)21)22(27)26-11-9-25(10-12-26)17(3)19-5-4-8-23-14-19/h4-8,13-14,17,24H,9-12H2,1-3H3 |
| InChIKey | JUSTUSDWWNDBNC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|