C15H25Cl3N4O — CID 119903305
(1-aminocyclopropyl)-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]methanone;trihydrochloride (PubChem CID 119903305) has the molecular formula C15H25Cl3N4O and a molecular weight of 383.75 g/mol. Its IUPAC name is (1-aminocyclopropyl)-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]methanone;trihydrochloride.
| Compound Name | (1-aminocyclopropyl)-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]methanone;trihydrochloride |
|---|---|
| PubChem CID | 119903305 |
| Molecular Formula | C15H25Cl3N4O |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (1-aminocyclopropyl)-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]methanone;trihydrochloride |
| SMILES | CC(c1cccnc1)N1CCN(C(=O)C2(N)CC2)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C15H22N4O.3ClH/c1-12(13-3-2-6-17-11-13)18-7-9-19(10-8-18)14(20)15(16)4-5-15;;;/h2-3,6,11-12H,4-5,7-10,16H2,1H3;3*1H |
| InChIKey | PSLKWZKNTZLMKM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |