C16H25ClN4O — CID 122081611
[4-(1-pyridin-3-ylethyl)piperazin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone;hydrochloride (PubChem CID 122081611) has the molecular formula C16H25ClN4O and a molecular weight of 324.86 g/mol. Its IUPAC name is [4-(1-pyridin-3-ylethyl)piperazin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone;hydrochloride.
| Compound Name | [4-(1-pyridin-3-ylethyl)piperazin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 122081611 |
| Molecular Formula | C16H25ClN4O |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [4-(1-pyridin-3-ylethyl)piperazin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone;hydrochloride |
| SMILES | CC(c1cccnc1)N1CCN(C(=O)[C@@H]2CCCN2)CC1.Cl |
| InChI | InChI=1S/C16H24N4O.ClH/c1-13(14-4-2-6-17-12-14)19-8-10-20(11-9-19)16(21)15-5-3-7-18-15;/h2,4,6,12-13,15,18H,3,5,7-11H2,1H3;1H/t13?,15-;/m0./s1 |
| InChIKey | LEKVKLWGVPEXIE-LDCKTULKSA-N |
| XLogP | 1.46 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |