C23H27N3O — CID 31282088
(2,3-dimethyl-1H-indol-5-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 31282088) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 31282088 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1cccc(CN2CCN(C(=O)c3ccc4[nH]c(C)c(C)c4c3)CC2)c1 |
| InChI | InChI=1S/C23H27N3O/c1-16-5-4-6-19(13-16)15-25-9-11-26(12-10-25)23(27)20-7-8-22-21(14-20)17(2)18(3)24-22/h4-8,13-14,24H,9-12,15H2,1-3H3 |
| InChIKey | GAWFOFBVMMLMPM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|