C19H23N3O2 — CID 70779876
1-methyl-5-[4-[(3-methylphenyl)methyl]piperazine-1-carbonyl]pyridin-2-one (PubChem CID 70779876) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-methyl-5-[4-[(3-methylphenyl)methyl]piperazine-1-carbonyl]pyridin-2-one.
| Compound Name | 1-methyl-5-[4-[(3-methylphenyl)methyl]piperazine-1-carbonyl]pyridin-2-one |
|---|---|
| PubChem CID | 70779876 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-methyl-5-[4-[(3-methylphenyl)methyl]piperazine-1-carbonyl]pyridin-2-one |
| SMILES | Cc1cccc(CN2CCN(C(=O)c3ccc(=O)n(C)c3)CC2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-15-4-3-5-16(12-15)13-21-8-10-22(11-9-21)19(24)17-6-7-18(23)20(2)14-17/h3-7,12,14H,8-11,13H2,1-2H3 |
| InChIKey | GMPIEGYTNFDXHE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |