C23H21F2N3O2 — CID 91955061
1-(4-fluorophenyl)-5-[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]pyridin-2-one (PubChem CID 91955061) has the molecular formula C23H21F2N3O2 and a molecular weight of 409.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]pyridin-2-one.
| Compound Name | 1-(4-fluorophenyl)-5-[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]pyridin-2-one |
|---|---|
| PubChem CID | 91955061 |
| Molecular Formula | C23H21F2N3O2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-(4-fluorophenyl)-5-[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]pyridin-2-one |
| SMILES | O=C(c1ccc(=O)n(-c2ccc(F)cc2)c1)N1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H21F2N3O2/c24-19-5-7-21(8-6-19)28-16-18(4-9-22(28)29)23(30)27-12-10-26(11-13-27)15-17-2-1-3-20(25)14-17/h1-9,14,16H,10-13,15H2 |
| InChIKey | JLBIEAAZBSVFBL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |