C24H25F3N4O — CID 55414599
6,7,8,9-tetrahydro-5H-carbazol-3-yl-[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methanone (PubChem CID 55414599) has the molecular formula C24H25F3N4O and a molecular weight of 442.49 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-carbazol-3-yl-[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | 6,7,8,9-tetrahydro-5H-carbazol-3-yl-[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 55414599 |
| Molecular Formula | C24H25F3N4O |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-carbazol-3-yl-[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1ccc2[nH]c3c(c2c1)CCCC3)N1CCCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C24H25F3N4O/c25-24(26,27)17-7-9-22(28-15-17)30-10-3-11-31(13-12-30)23(32)16-6-8-21-19(14-16)18-4-1-2-5-20(18)29-21/h6-9,14-15,29H,1-5,10-13H2 |
| InChIKey | FSUUDIKLYDEJMD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|