C16H12BrN3O4 — CID 33189898
(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-nitrofuran-2-yl)methanone (PubChem CID 33189898) has the molecular formula C16H12BrN3O4 and a molecular weight of 390.19 g/mol. Its IUPAC name is (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-nitrofuran-2-yl)methanone.
| Compound Name | (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 33189898 |
| Molecular Formula | C16H12BrN3O4 |
| Molecular Weight | 390.19 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-nitrofuran-2-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N1CCc2[nH]c3ccc(Br)cc3c2C1 |
| InChI | InChI=1S/C16H12BrN3O4/c17-9-1-2-12-10(7-9)11-8-19(6-5-13(11)18-12)16(21)14-3-4-15(24-14)20(22)23/h1-4,7,18H,5-6,8H2 |
| InChIKey | AFRKTKIXGCFWEH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|