C20H18BrClN2O3 — CID 30858360
(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(3-chloro-4,5-dimethoxyphenyl)methanone (PubChem CID 30858360) has the molecular formula C20H18BrClN2O3 and a molecular weight of 449.73 g/mol. Its IUPAC name is (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(3-chloro-4,5-dimethoxyphenyl)methanone.
| Compound Name | (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(3-chloro-4,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 30858360 |
| Molecular Formula | C20H18BrClN2O3 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(3-chloro-4,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCc3[nH]c4ccc(Br)cc4c3C2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H18BrClN2O3/c1-26-18-8-11(7-15(22)19(18)27-2)20(25)24-6-5-17-14(10-24)13-9-12(21)3-4-16(13)23-17/h3-4,7-9,23H,5-6,10H2,1-2H3 |
| InChIKey | VHIVHRTVHPGSDG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|