C27H20FN3O3 — CID 33180766
2-benzyl-5-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)isoindole-1,3-dione (PubChem CID 33180766) has the molecular formula C27H20FN3O3 and a molecular weight of 453.47 g/mol. Its IUPAC name is 2-benzyl-5-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)isoindole-1,3-dione.
| Compound Name | 2-benzyl-5-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 33180766 |
| Molecular Formula | C27H20FN3O3 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-benzyl-5-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O)N1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C27H20FN3O3/c28-18-7-9-23-20(13-18)22-15-30(11-10-24(22)29-23)25(32)17-6-8-19-21(12-17)27(34)31(26(19)33)14-16-4-2-1-3-5-16/h1-9,12-13,29H,10-11,14-15H2 |
| InChIKey | QTOJPWGNWXAMPC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|