C22H21FN4O3 — CID 30858144
(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone (PubChem CID 30858144) has the molecular formula C22H21FN4O3 and a molecular weight of 408.43 g/mol. Its IUPAC name is (8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone.
| Compound Name | (8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 30858144 |
| Molecular Formula | C22H21FN4O3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
| SMILES | O=C(c1ccc(N2CCCC2)c([N+](=O)[O-])c1)N1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C22H21FN4O3/c23-15-4-5-18-16(12-15)17-13-26(10-7-19(17)24-18)22(28)14-3-6-20(21(11-14)27(29)30)25-8-1-2-9-25/h3-6,11-12,24H,1-2,7-10,13H2 |
| InChIKey | XXXXWQFKQHZUGH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|