C25H26N4O5 — CID 32757017
methyl 2-[1-(2-nitrophenyl)piperidine-4-carbonyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 32757017) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is methyl 2-[1-(2-nitrophenyl)piperidine-4-carbonyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-[1-(2-nitrophenyl)piperidine-4-carbonyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 32757017 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | methyl 2-[1-(2-nitrophenyl)piperidine-4-carbonyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CN(C(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1)CC3 |
| InChI | InChI=1S/C25H26N4O5/c1-34-25(31)17-6-7-20-18(14-17)19-15-28(13-10-21(19)26-20)24(30)16-8-11-27(12-9-16)22-4-2-3-5-23(22)29(32)33/h2-7,14,16,26H,8-13,15H2,1H3 |
| InChIKey | GYXPWSZWARUAEC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 108.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|