C19H27N3O3 — CID 40954386
[(3R,5R)-3,5-dimethylpiperidin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone (PubChem CID 40954386) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is [(3R,5R)-3,5-dimethylpiperidin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone.
| Compound Name | [(3R,5R)-3,5-dimethylpiperidin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 40954386 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | [(3R,5R)-3,5-dimethylpiperidin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)C1 |
| InChI | InChI=1S/C19H27N3O3/c1-14-11-15(2)13-21(12-14)19(23)16-7-9-20(10-8-16)17-5-3-4-6-18(17)22(24)25/h3-6,14-16H,7-13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | QVAKQURDYNNUIF-HUUCEWRRSA-N |
| XLogP | 3.32 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|